C24H32N2O5-2 — CID 20841031
(Z)-but-2-enedioate;N-(4-cyclopentylphenyl)-N-ethyl-2-piperidin-1-ylacetamide (PubChem CID 20841031) has the molecular formula C24H32N2O5-2 and a molecular weight of 428.53 g/mol. Its IUPAC name is (Z)-but-2-enedioate;N-(4-cyclopentylphenyl)-N-ethyl-2-piperidin-1-ylacetamide.
| Compound Name | (Z)-but-2-enedioate;N-(4-cyclopentylphenyl)-N-ethyl-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 20841031 |
| Molecular Formula | C24H32N2O5-2 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | (Z)-but-2-enedioate;N-(4-cyclopentylphenyl)-N-ethyl-2-piperidin-1-ylacetamide |
| SMILES | CCN(C(=O)CN1CCCCC1)c1ccc(C2CCCC2)cc1.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C20H30N2O.C4H4O4/c1-2-22(20(23)16-21-14-6-3-7-15-21)19-12-10-18(11-13-19)17-8-4-5-9-17;5-3(6)1-2-4(7)8/h10-13,17H,2-9,14-16H2,1H3;1-2H,(H,5,6)(H,7,8)/p-2/b;2-1- |
| InChIKey | HVOUTEKBDWSIRW-BTJKTKAUSA-L |
| XLogP | 1.23 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|