C26H35N3O11S — CID 6446038
bis((E)-but-2-enedioic acid);2-(4-methylpiperazin-1-yl)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone (PubChem CID 6446038) has the molecular formula C26H35N3O11S and a molecular weight of 597.64 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);2-(4-methylpiperazin-1-yl)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | bis((E)-but-2-enedioic acid);2-(4-methylpiperazin-1-yl)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 6446038 |
| Molecular Formula | C26H35N3O11S |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | bis((E)-but-2-enedioic acid);2-(4-methylpiperazin-1-yl)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
| SMILES | CN1CCN(CC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H27N3O3S.2C4H4O4/c1-19-11-13-20(14-12-19)15-18(22)16-5-7-17(8-6-16)25(23,24)21-9-3-2-4-10-21;2*5-3(6)1-2-4(7)8/h5-8H,2-4,9-15H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | ORNAKVLLQJYICU-LVEZLNDCSA-N |
| XLogP | 0.71 |
| TPSA | 210.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|