C25H39N3O3S — CID 110828107
2-[4-[2-(azepan-1-yl)ethyl]piperidin-1-yl]-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110828107) has the molecular formula C25H39N3O3S and a molecular weight of 461.67 g/mol. Its IUPAC name is 2-[4-[2-(azepan-1-yl)ethyl]piperidin-1-yl]-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-[4-[2-(azepan-1-yl)ethyl]piperidin-1-yl]-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110828107 |
| Molecular Formula | C25H39N3O3S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 2-[4-[2-(azepan-1-yl)ethyl]piperidin-1-yl]-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone |
| SMILES | O=C(CN1CCC(CCN2CCCCCC2)CC1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C25H39N3O3S/c29-25(23-7-9-24(10-8-23)32(30,31)28-16-5-6-17-28)21-27-19-12-22(13-20-27)11-18-26-14-3-1-2-4-15-26/h7-10,22H,1-6,11-21H2 |
| InChIKey | NWVBXZQDSZCJTJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |