C15H12O4 — CID 20843233
3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid (PubChem CID 20843233) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid.
| Compound Name | 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid |
|---|---|
| PubChem CID | 20843233 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid |
| SMILES | O=C(O)C1(O)C(O)=CCc2ccc3ccccc3c21 |
| InChI | InChI=1S/C15H12O4/c16-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)15(12,19)14(17)18/h1-6,8,16,19H,7H2,(H,17,18) |
| InChIKey | IQVAPBWAHYSMLL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |