3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid

C15H12O4 — CID 20843233

IUPAC3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid
SMILESO=C(O)C1(O)C(O)=CCc2ccc3ccccc3c21
InChIInChI=1S/C15H12O4/c16-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)15(12,19)14(17)18/h1-6,8,16,19H,7H2,(H,17,18)
InChIKeyIQVAPBWAHYSMLL-UHFFFAOYSA-N
MW256.26 g/mol
LogP2.11
Rot. Bonds1

About 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid

3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid (PubChem CID 20843233) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid.

Molecular Properties

Compound Name3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid
PubChem CID20843233
Molecular FormulaC15H12O4
Molecular Weight256.26 g/mol
Exact Mass256.07
IUPAC Name3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid
SMILESO=C(O)C1(O)C(O)=CCc2ccc3ccccc3c21
InChIInChI=1S/C15H12O4/c16-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)15(12,19)14(17)18/h1-6,8,16,19H,7H2,(H,17,18)
InChIKeyIQVAPBWAHYSMLL-UHFFFAOYSA-N
XLogP2.11
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.26
LogP ≤ 52.11
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid?
The IUPAC name of 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid (CID 20843233) is 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid.
What is the SMILES notation for 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid?
The canonical SMILES for 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid is O=C(O)C1(O)C(O)=CCc2ccc3ccccc3c21.
What is the InChIKey of 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid?
The InChIKey is IQVAPBWAHYSMLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O4/c16-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)15(12,19)14(17)18/h1-6,8,16,19H,7H2,(H,17,18).
What are the key properties of 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid?
3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid has a molecular weight of 256.26 g/mol, XLogP of 2.11, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-1H-phenanthrene-4-carboxylic acid is sourced from PubChem (CID 20843233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).