C18H14ClF4N3O — CID 20844811
(E)-1-(2,4-difluorophenyl)-N-[1-(2,4-difluorophenyl)-2-imidazol-1-ylethoxy]methanimine;hydrochloride (PubChem CID 20844811) has the molecular formula C18H14ClF4N3O and a molecular weight of 399.78 g/mol. Its IUPAC name is (E)-1-(2,4-difluorophenyl)-N-[1-(2,4-difluorophenyl)-2-imidazol-1-ylethoxy]methanimine;hydrochloride.
| Compound Name | (E)-1-(2,4-difluorophenyl)-N-[1-(2,4-difluorophenyl)-2-imidazol-1-ylethoxy]methanimine;hydrochloride |
|---|---|
| PubChem CID | 20844811 |
| Molecular Formula | C18H14ClF4N3O |
| Molecular Weight | 399.78 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | (E)-1-(2,4-difluorophenyl)-N-[1-(2,4-difluorophenyl)-2-imidazol-1-ylethoxy]methanimine;hydrochloride |
| SMILES | Cl.Fc1ccc(/C=N/OC(Cn2ccnc2)c2ccc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C18H13F4N3O.ClH/c19-13-2-1-12(16(21)7-13)9-24-26-18(10-25-6-5-23-11-25)15-4-3-14(20)8-17(15)22;/h1-9,11,18H,10H2;1H/b24-9+; |
| InChIKey | GYXMPUYLJLBCHH-REHAKMGWSA-N |
| XLogP | 4.65 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|