C29H43N3O5 — CID 20844947
(E,2E)-N-[3-(4-benzylpiperazin-1-yl)propoxy]-2-pentylidenecyclohexan-1-imine;(E)-but-2-enedioic acid (PubChem CID 20844947) has the molecular formula C29H43N3O5 and a molecular weight of 513.68 g/mol. Its IUPAC name is (E,2E)-N-[3-(4-benzylpiperazin-1-yl)propoxy]-2-pentylidenecyclohexan-1-imine;(E)-but-2-enedioic acid.
| Compound Name | (E,2E)-N-[3-(4-benzylpiperazin-1-yl)propoxy]-2-pentylidenecyclohexan-1-imine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 20844947 |
| Molecular Formula | C29H43N3O5 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | (E,2E)-N-[3-(4-benzylpiperazin-1-yl)propoxy]-2-pentylidenecyclohexan-1-imine;(E)-but-2-enedioic acid |
| SMILES | CCCC/C=C1\CCCC\C1=N/OCCCN1CCN(Cc2ccccc2)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C25H39N3O.C4H4O4/c1-2-3-5-13-24-14-8-9-15-25(24)26-29-21-10-16-27-17-19-28(20-18-27)22-23-11-6-4-7-12-23;5-3(6)1-2-4(7)8/h4,6-7,11-13H,2-3,5,8-10,14-22H2,1H3;1-2H,(H,5,6)(H,7,8)/b24-13+,26-25+;2-1+ |
| InChIKey | AQWFZGLQHBQTCU-PEMAVYBQSA-N |
| XLogP | 4.97 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|