C27H43N3O9 — CID 50990479
bis((E)-but-2-enedioic acid);(E,2Z)-N-[3-(4-methylpiperazin-1-yl)propoxy]-2-pentylidenecyclohexan-1-imine (PubChem CID 50990479) has the molecular formula C27H43N3O9 and a molecular weight of 553.65 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);(E,2Z)-N-[3-(4-methylpiperazin-1-yl)propoxy]-2-pentylidenecyclohexan-1-imine.
| Compound Name | bis((E)-but-2-enedioic acid);(E,2Z)-N-[3-(4-methylpiperazin-1-yl)propoxy]-2-pentylidenecyclohexan-1-imine |
|---|---|
| PubChem CID | 50990479 |
| Molecular Formula | C27H43N3O9 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | bis((E)-but-2-enedioic acid);(E,2Z)-N-[3-(4-methylpiperazin-1-yl)propoxy]-2-pentylidenecyclohexan-1-imine |
| SMILES | CCCC/C=C1/CCCC/C1=N\OCCCN1CCN(C)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H35N3O.2C4H4O4/c1-3-4-5-9-18-10-6-7-11-19(18)20-23-17-8-12-22-15-13-21(2)14-16-22;2*5-3(6)1-2-4(7)8/h9H,3-8,10-17H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b18-9-,20-19+;2*2-1+ |
| InChIKey | RHMCSFFKXDNWAT-KVGYQMJXSA-N |
| XLogP | 3.11 |
| TPSA | 177.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|