C22H40N2O5 — CID 173439122
but-2-enedioic acid;2-(cyclododecylideneamino)oxy-N,N-diethylethanamine (PubChem CID 173439122) has the molecular formula C22H40N2O5 and a molecular weight of 412.57 g/mol. Its IUPAC name is but-2-enedioic acid;2-(cyclododecylideneamino)oxy-N,N-diethylethanamine.
| Compound Name | but-2-enedioic acid;2-(cyclododecylideneamino)oxy-N,N-diethylethanamine |
|---|---|
| PubChem CID | 173439122 |
| Molecular Formula | C22H40N2O5 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | but-2-enedioic acid;2-(cyclododecylideneamino)oxy-N,N-diethylethanamine |
| SMILES | CCN(CC)CCON=C1CCCCCCCCCCC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H36N2O.C4H4O4/c1-3-20(4-2)16-17-21-19-18-14-12-10-8-6-5-7-9-11-13-15-18;5-3(6)1-2-4(7)8/h3-17H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | MTWNJKFHMFBTMG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|