C25H21N3O4 — CID 20845186
[2-[2-(4-acetamidophenyl)-2-oxoethanehydrazonoyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 20845186) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is [2-[2-(4-acetamidophenyl)-2-oxoethanehydrazonoyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-[2-(4-acetamidophenyl)-2-oxoethanehydrazonoyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 20845186 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [2-[2-(4-acetamidophenyl)-2-oxoethanehydrazonoyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | CC(=O)Nc1ccc(C(=O)/C(=N/N)c2ccccc2OC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3O4/c1-17(29)27-20-14-12-19(13-15-20)25(31)24(28-26)21-9-5-6-10-22(21)32-23(30)16-11-18-7-3-2-4-8-18/h2-16H,26H2,1H3,(H,27,29)/b16-11+,28-24+ |
| InChIKey | GIXNHKYKZOBOLU-WWECBPANSA-N |
| XLogP | 3.81 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|