C10H14N4OS — CID 20845570
1-propylsulfanyl-3-[(E)-pyridin-3-ylmethylideneamino]urea (PubChem CID 20845570) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is 1-propylsulfanyl-3-[(E)-pyridin-3-ylmethylideneamino]urea.
| Compound Name | 1-propylsulfanyl-3-[(E)-pyridin-3-ylmethylideneamino]urea |
|---|---|
| PubChem CID | 20845570 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-propylsulfanyl-3-[(E)-pyridin-3-ylmethylideneamino]urea |
| SMILES | CCCSNC(=O)N/N=C/c1cccnc1 |
| InChI | InChI=1S/C10H14N4OS/c1-2-6-16-14-10(15)13-12-8-9-4-3-5-11-7-9/h3-5,7-8H,2,6H2,1H3,(H2,13,14,15)/b12-8+ |
| InChIKey | CNMVOBNYCUKWCU-XYOKQWHBSA-N |
| XLogP | 1.77 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|