C17H30N2 — CID 20846911
(1S,2S,9S,10S)-2-ethyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane (PubChem CID 20846911) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is (1S,2S,9S,10S)-2-ethyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane.
| Compound Name | (1S,2S,9S,10S)-2-ethyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
|---|---|
| PubChem CID | 20846911 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | (1S,2S,9S,10S)-2-ethyl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
| SMILES | CC[C@@]12CCCCN1C[C@@H]1C[C@H]2CN2CCCC[C@@H]12 |
| InChI | InChI=1S/C17H30N2/c1-2-17-8-4-6-10-19(17)12-14-11-15(17)13-18-9-5-3-7-16(14)18/h14-16H,2-13H2,1H3/t14-,15-,16-,17-/m0/s1 |
| InChIKey | PDHYEINWLCZHNL-QAETUUGQSA-N |
| XLogP | 3.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |