C25H24N2OS — CID 20851269
N-benzyl-8-methyl-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 20851269) has the molecular formula C25H24N2OS and a molecular weight of 400.55 g/mol. Its IUPAC name is N-benzyl-8-methyl-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-benzyl-8-methyl-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 20851269 |
| Molecular Formula | C25H24N2OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-benzyl-8-methyl-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCC1=Nc2cc(C(=O)NCc3ccccc3)ccc2Sc2ccc(C)cc21 |
| InChI | InChI=1S/C25H24N2OS/c1-3-7-21-20-14-17(2)10-12-23(20)29-24-13-11-19(15-22(24)27-21)25(28)26-16-18-8-5-4-6-9-18/h4-6,8-15H,3,7,16H2,1-2H3,(H,26,28) |
| InChIKey | UUVBXPKQRILITL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |