C20H15ClN2O2 — CID 20853909
7-chloro-N-(4-ethylphenyl)furo[2,3-b]quinoline-2-carboxamide (PubChem CID 20853909) has the molecular formula C20H15ClN2O2 and a molecular weight of 350.81 g/mol. Its IUPAC name is 7-chloro-N-(4-ethylphenyl)furo[2,3-b]quinoline-2-carboxamide.
| Compound Name | 7-chloro-N-(4-ethylphenyl)furo[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 20853909 |
| Molecular Formula | C20H15ClN2O2 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 7-chloro-N-(4-ethylphenyl)furo[2,3-b]quinoline-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2cc3cc4ccc(Cl)cc4nc3o2)cc1 |
| InChI | InChI=1S/C20H15ClN2O2/c1-2-12-3-7-16(8-4-12)22-19(24)18-10-14-9-13-5-6-15(21)11-17(13)23-20(14)25-18/h3-11H,2H2,1H3,(H,22,24) |
| InChIKey | UDACYJBNGMZOQE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |