C25H30N4OS — CID 20854587
N-[2-(azepan-1-yl)ethyl]-2-(3-methylsulfanylanilino)quinoline-4-carboxamide (PubChem CID 20854587) has the molecular formula C25H30N4OS and a molecular weight of 434.61 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-2-(3-methylsulfanylanilino)quinoline-4-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-2-(3-methylsulfanylanilino)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 20854587 |
| Molecular Formula | C25H30N4OS |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-2-(3-methylsulfanylanilino)quinoline-4-carboxamide |
| SMILES | CSc1cccc(Nc2cc(C(=O)NCCN3CCCCCC3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H30N4OS/c1-31-20-10-8-9-19(17-20)27-24-18-22(21-11-4-5-12-23(21)28-24)25(30)26-13-16-29-14-6-2-3-7-15-29/h4-5,8-12,17-18H,2-3,6-7,13-16H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | KUFMNNNEWXGOPH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |