C19H12ClFN2O3 — CID 20855545
N-(3-chloro-4-fluorophenyl)-1-methyl-4-oxochromeno[4,3-b]pyrrole-2-carboxamide (PubChem CID 20855545) has the molecular formula C19H12ClFN2O3 and a molecular weight of 370.77 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-methyl-4-oxochromeno[4,3-b]pyrrole-2-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-methyl-4-oxochromeno[4,3-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 20855545 |
| Molecular Formula | C19H12ClFN2O3 |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-methyl-4-oxochromeno[4,3-b]pyrrole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(F)c(Cl)c2)cc2c(=O)oc3ccccc3c21 |
| InChI | InChI=1S/C19H12ClFN2O3/c1-23-15(18(24)22-10-6-7-14(21)13(20)8-10)9-12-17(23)11-4-2-3-5-16(11)26-19(12)25/h2-9H,1H3,(H,22,24) |
| InChIKey | NRJSJTLKTGBDNP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|