C20H14ClFN2O3 — CID 53054830
N-(2-chloro-4-fluorophenyl)-1-ethyl-4-oxochromeno[4,3-b]pyrrole-2-carboxamide (PubChem CID 53054830) has the molecular formula C20H14ClFN2O3 and a molecular weight of 384.79 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-1-ethyl-4-oxochromeno[4,3-b]pyrrole-2-carboxamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-1-ethyl-4-oxochromeno[4,3-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 53054830 |
| Molecular Formula | C20H14ClFN2O3 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-1-ethyl-4-oxochromeno[4,3-b]pyrrole-2-carboxamide |
| SMILES | CCn1c(C(=O)Nc2ccc(F)cc2Cl)cc2c(=O)oc3ccccc3c21 |
| InChI | InChI=1S/C20H14ClFN2O3/c1-2-24-16(19(25)23-15-8-7-11(22)9-14(15)21)10-13-18(24)12-5-3-4-6-17(12)27-20(13)26/h3-10H,2H2,1H3,(H,23,25) |
| InChIKey | ZALORPRMHWMLPW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|