C28H32ClFN4OS — CID 20858323
2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide (PubChem CID 20858323) has the molecular formula C28H32ClFN4OS and a molecular weight of 527.11 g/mol. Its IUPAC name is 2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide.
| Compound Name | 2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 20858323 |
| Molecular Formula | C28H32ClFN4OS |
| Molecular Weight | 527.11 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 2-[(7-chloro-1,2,3,4-tetrahydroacridin-9-yl)sulfanyl]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide |
| SMILES | O=C(CSc1c2c(nc3ccc(Cl)cc13)CCCC2)NCCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H32ClFN4OS/c29-20-6-11-26-24(18-20)28(23-4-1-2-5-25(23)32-26)36-19-27(35)31-12-3-13-33-14-16-34(17-15-33)22-9-7-21(30)8-10-22/h6-11,18H,1-5,12-17,19H2,(H,31,35) |
| InChIKey | LTNLSXDQVPYVMG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.11 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|