C22H31N3O4S — CID 20859403
N-butyl-6-(diethylsulfamoyl)-N-methyl-4-oxo-1-prop-2-enylquinoline-3-carboxamide (PubChem CID 20859403) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is N-butyl-6-(diethylsulfamoyl)-N-methyl-4-oxo-1-prop-2-enylquinoline-3-carboxamide.
| Compound Name | N-butyl-6-(diethylsulfamoyl)-N-methyl-4-oxo-1-prop-2-enylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 20859403 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-butyl-6-(diethylsulfamoyl)-N-methyl-4-oxo-1-prop-2-enylquinoline-3-carboxamide |
| SMILES | C=CCn1cc(C(=O)N(C)CCCC)c(=O)c2cc(S(=O)(=O)N(CC)CC)ccc21 |
| InChI | InChI=1S/C22H31N3O4S/c1-6-10-14-23(5)22(27)19-16-24(13-7-2)20-12-11-17(15-18(20)21(19)26)30(28,29)25(8-3)9-4/h7,11-12,15-16H,2,6,8-10,13-14H2,1,3-5H3 |
| InChIKey | CKLCOMJUYSXXBZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|