C27H42N4O4S — CID 46255153
N-[2-[bis(2-methylpropyl)amino]ethyl]-6-(diethylsulfamoyl)-4-oxo-1-prop-2-enylquinoline-3-carboxamide (PubChem CID 46255153) has the molecular formula C27H42N4O4S and a molecular weight of 518.72 g/mol. Its IUPAC name is N-[2-[bis(2-methylpropyl)amino]ethyl]-6-(diethylsulfamoyl)-4-oxo-1-prop-2-enylquinoline-3-carboxamide.
| Compound Name | N-[2-[bis(2-methylpropyl)amino]ethyl]-6-(diethylsulfamoyl)-4-oxo-1-prop-2-enylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46255153 |
| Molecular Formula | C27H42N4O4S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | N-[2-[bis(2-methylpropyl)amino]ethyl]-6-(diethylsulfamoyl)-4-oxo-1-prop-2-enylquinoline-3-carboxamide |
| SMILES | C=CCn1cc(C(=O)NCCN(CC(C)C)CC(C)C)c(=O)c2cc(S(=O)(=O)N(CC)CC)ccc21 |
| InChI | InChI=1S/C27H42N4O4S/c1-8-14-30-19-24(27(33)28-13-15-29(17-20(4)5)18-21(6)7)26(32)23-16-22(11-12-25(23)30)36(34,35)31(9-2)10-3/h8,11-12,16,19-21H,1,9-10,13-15,17-18H2,2-7H3,(H,28,33) |
| InChIKey | VHTAEKMGUOIYMN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|