C25H31N3O4S — CID 20860109
2-[[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfanyl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 20860109) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfanyl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 20860109 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfanyl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | COc1ccc(-c2nc(CSCC(=O)NCCCN(C)c3ccccc3)c(C)o2)cc1OC |
| InChI | InChI=1S/C25H31N3O4S/c1-18-21(27-25(32-18)19-11-12-22(30-3)23(15-19)31-4)16-33-17-24(29)26-13-8-14-28(2)20-9-6-5-7-10-20/h5-7,9-12,15H,8,13-14,16-17H2,1-4H3,(H,26,29) |
| InChIKey | XZLXDRUWJOUACX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|