C21H39ClN2O2+2 — CID 2086224
2-[[(2S)-3-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-2-hydroxypropyl]azaniumyl]ethyl-di(propan-2-yl)azanium (PubChem CID 2086224) has the molecular formula C21H39ClN2O2+2 and a molecular weight of 387.01 g/mol. Its IUPAC name is 2-[[(2S)-3-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-2-hydroxypropyl]azaniumyl]ethyl-di(propan-2-yl)azanium.
| Compound Name | 2-[[(2S)-3-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-2-hydroxypropyl]azaniumyl]ethyl-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 2086224 |
| Molecular Formula | C21H39ClN2O2+2 |
| Molecular Weight | 387.01 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 2-[[(2S)-3-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-2-hydroxypropyl]azaniumyl]ethyl-di(propan-2-yl)azanium |
| SMILES | Cc1cc(OC[C@@H](O)C[NH2+]CC[NH+](C(C)C)C(C)C)c(C(C)C)cc1Cl |
| InChI | InChI=1S/C21H37ClN2O2/c1-14(2)19-11-20(22)17(7)10-21(19)26-13-18(25)12-23-8-9-24(15(3)4)16(5)6/h10-11,14-16,18,23,25H,8-9,12-13H2,1-7H3/p+2/t18-/m0/s1 |
| InChIKey | PVNHDIUSSNGKJM-SFHVURJKSA-P |
| XLogP | 1.78 |
| TPSA | 50.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.01 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|