C18H30ClNO2 — CID 47007175
1-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-3-(2-methylbutan-2-ylamino)propan-2-ol (PubChem CID 47007175) has the molecular formula C18H30ClNO2 and a molecular weight of 327.90 g/mol. Its IUPAC name is 1-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-3-(2-methylbutan-2-ylamino)propan-2-ol.
| Compound Name | 1-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-3-(2-methylbutan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 47007175 |
| Molecular Formula | C18H30ClNO2 |
| Molecular Weight | 327.90 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 1-(4-chloro-5-methyl-2-propan-2-ylphenoxy)-3-(2-methylbutan-2-ylamino)propan-2-ol |
| SMILES | CCC(C)(C)NCC(O)COc1cc(C)c(Cl)cc1C(C)C |
| InChI | InChI=1S/C18H30ClNO2/c1-7-18(5,6)20-10-14(21)11-22-17-8-13(4)16(19)9-15(17)12(2)3/h8-9,12,14,20-21H,7,10-11H2,1-6H3 |
| InChIKey | IPOWXDYINOKWLN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.90 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |