C23H26N2O4S — CID 20862811
ethyl 3-[[[(2S)-4-methylsulfanyl-2-(3-oxo-1H-isoindol-2-yl)butanoyl]amino]methyl]benzoate (PubChem CID 20862811) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is ethyl 3-[[[(2S)-4-methylsulfanyl-2-(3-oxo-1H-isoindol-2-yl)butanoyl]amino]methyl]benzoate.
| Compound Name | ethyl 3-[[[(2S)-4-methylsulfanyl-2-(3-oxo-1H-isoindol-2-yl)butanoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 20862811 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | ethyl 3-[[[(2S)-4-methylsulfanyl-2-(3-oxo-1H-isoindol-2-yl)butanoyl]amino]methyl]benzoate |
| SMILES | CCOC(=O)c1cccc(CNC(=O)[C@H](CCSC)N2Cc3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H26N2O4S/c1-3-29-23(28)17-9-6-7-16(13-17)14-24-21(26)20(11-12-30-2)25-15-18-8-4-5-10-19(18)22(25)27/h4-10,13,20H,3,11-12,14-15H2,1-2H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | OBLMNHXSLZTIIE-FQEVSTJZSA-N |
| XLogP | 3.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |