C27H29N3O4S — CID 20865784
2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenyl-N-(3-phenylpropyl)propanamide (PubChem CID 20865784) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenyl-N-(3-phenylpropyl)propanamide.
| Compound Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenyl-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 20865784 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenyl-N-(3-phenylpropyl)propanamide |
| SMILES | O=C1CCc2cc(S(=O)(=O)NC(Cc3ccccc3)C(=O)NCCCc3ccccc3)ccc2N1 |
| InChI | InChI=1S/C27H29N3O4S/c31-26-16-13-22-19-23(14-15-24(22)29-26)35(33,34)30-25(18-21-10-5-2-6-11-21)27(32)28-17-7-12-20-8-3-1-4-9-20/h1-6,8-11,14-15,19,25,30H,7,12-13,16-18H2,(H,28,32)(H,29,31) |
| InChIKey | XXVMTCMLZMNSEQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|