C28H32N4O4S — CID 20865835
N-[3-(N-methylanilino)propyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenylpropanamide (PubChem CID 20865835) has the molecular formula C28H32N4O4S and a molecular weight of 520.66 g/mol. Its IUPAC name is N-[3-(N-methylanilino)propyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N-[3-(N-methylanilino)propyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 20865835 |
| Molecular Formula | C28H32N4O4S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | N-[3-(N-methylanilino)propyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenylpropanamide |
| SMILES | CN(CCCNC(=O)C(Cc1ccccc1)NS(=O)(=O)c1ccc2c(c1)CCC(=O)N2)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O4S/c1-32(23-11-6-3-7-12-23)18-8-17-29-28(34)26(19-21-9-4-2-5-10-21)31-37(35,36)24-14-15-25-22(20-24)13-16-27(33)30-25/h2-7,9-12,14-15,20,26,31H,8,13,16-19H2,1H3,(H,29,34)(H,30,33) |
| InChIKey | RKSWQXGRNDCOOM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|