C27H30N4O4S — CID 20865834
N-[[4-(dimethylamino)phenyl]methyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenylpropanamide (PubChem CID 20865834) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 20865834 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]-3-phenylpropanamide |
| SMILES | CN(C)c1ccc(CNC(=O)C(Cc2ccccc2)NS(=O)(=O)c2ccc3c(c2)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C27H30N4O4S/c1-31(2)22-11-8-20(9-12-22)18-28-27(33)25(16-19-6-4-3-5-7-19)30-36(34,35)23-13-14-24-21(17-23)10-15-26(32)29-24/h3-9,11-14,17,25,30H,10,15-16,18H2,1-2H3,(H,28,33)(H,29,32) |
| InChIKey | VUSOUMLFADCGLC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|