C21H18ClN3O5 — CID 20867752
N-(5-chloro-2,4-dimethoxyphenyl)-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide (PubChem CID 20867752) has the molecular formula C21H18ClN3O5 and a molecular weight of 427.84 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 20867752 |
| Molecular Formula | C21H18ClN3O5 |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide |
| SMILES | COc1cc(OC)c(NC(=O)Cn2ncc3c(=O)oc4ccc(C)cc4c32)cc1Cl |
| InChI | InChI=1S/C21H18ClN3O5/c1-11-4-5-16-12(6-11)20-13(21(27)30-16)9-23-25(20)10-19(26)24-15-7-14(22)17(28-2)8-18(15)29-3/h4-9H,10H2,1-3H3,(H,24,26) |
| InChIKey | QBSXOABSIHWPJQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|