C19H16N4O5S — CID 20867873
2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)-N-(4-sulfamoylphenyl)acetamide (PubChem CID 20867873) has the molecular formula C19H16N4O5S and a molecular weight of 412.43 g/mol. Its IUPAC name is 2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 20867873 |
| Molecular Formula | C19H16N4O5S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)-N-(4-sulfamoylphenyl)acetamide |
| SMILES | Cc1ccc2oc(=O)c3cnn(CC(=O)Nc4ccc(S(N)(=O)=O)cc4)c3c2c1 |
| InChI | InChI=1S/C19H16N4O5S/c1-11-2-7-16-14(8-11)18-15(19(25)28-16)9-21-23(18)10-17(24)22-12-3-5-13(6-4-12)29(20,26)27/h2-9H,10H2,1H3,(H,22,24)(H2,20,26,27) |
| InChIKey | ICZGXQMEFACLIU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|