C21H19N3O4 — CID 20867798
N-(4-methoxyphenyl)-N-methyl-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide (PubChem CID 20867798) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-methyl-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide.
| Compound Name | N-(4-methoxyphenyl)-N-methyl-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 20867798 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(4-methoxyphenyl)-N-methyl-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide |
| SMILES | COc1ccc(N(C)C(=O)Cn2ncc3c(=O)oc4ccc(C)cc4c32)cc1 |
| InChI | InChI=1S/C21H19N3O4/c1-13-4-9-18-16(10-13)20-17(21(26)28-18)11-22-24(20)12-19(25)23(2)14-5-7-15(27-3)8-6-14/h4-11H,12H2,1-3H3 |
| InChIKey | NBEKVKLITSDQCA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|