C25H27N3O5 — CID 20867825
N-[2-(3,4-diethoxyphenyl)ethyl]-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide (PubChem CID 20867825) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 20867825 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-(8-methyl-4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide |
| SMILES | CCOc1ccc(CCNC(=O)Cn2ncc3c(=O)oc4ccc(C)cc4c32)cc1OCC |
| InChI | InChI=1S/C25H27N3O5/c1-4-31-21-9-7-17(13-22(21)32-5-2)10-11-26-23(29)15-28-24-18-12-16(3)6-8-20(18)33-25(30)19(24)14-27-28/h6-9,12-14H,4-5,10-11,15H2,1-3H3,(H,26,29) |
| InChIKey | JQQBNXUMQNAQTE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|