C18H12ClN3O3 — CID 6622016
N-(3-chlorophenyl)-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide (PubChem CID 6622016) has the molecular formula C18H12ClN3O3 and a molecular weight of 353.77 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 6622016 |
| Molecular Formula | C18H12ClN3O3 |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-(3-chlorophenyl)-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1ncc2c(=O)oc3ccccc3c21)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H12ClN3O3/c19-11-4-3-5-12(8-11)21-16(23)10-22-17-13-6-1-2-7-15(13)25-18(24)14(17)9-20-22/h1-9H,10H2,(H,21,23) |
| InChIKey | HGWUENBYPBTJJA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|