C19H21N3O3 — CID 20873127
1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]chromeno[3,4-d]pyrazol-4-one (PubChem CID 20873127) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]chromeno[3,4-d]pyrazol-4-one.
| Compound Name | 1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]chromeno[3,4-d]pyrazol-4-one |
|---|---|
| PubChem CID | 20873127 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]chromeno[3,4-d]pyrazol-4-one |
| SMILES | CC1CCCC(C)N1C(=O)Cn1ncc2c(=O)oc3ccccc3c21 |
| InChI | InChI=1S/C19H21N3O3/c1-12-6-5-7-13(2)22(12)17(23)11-21-18-14-8-3-4-9-16(14)25-19(24)15(18)10-20-21/h3-4,8-10,12-13H,5-7,11H2,1-2H3 |
| InChIKey | YHCXACVOBPXWRU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|