C16H28O9 — CID 20871358
5-(hydroxymethyl)-14-methyl-2,4,11,13-tetraoxatricyclo[10.2.2.23,6]octadecane-15,16,17,18-tetrol (PubChem CID 20871358) has the molecular formula C16H28O9 and a molecular weight of 364.39 g/mol. Its IUPAC name is 5-(hydroxymethyl)-14-methyl-2,4,11,13-tetraoxatricyclo[10.2.2.23,6]octadecane-15,16,17,18-tetrol.
| Compound Name | 5-(hydroxymethyl)-14-methyl-2,4,11,13-tetraoxatricyclo[10.2.2.23,6]octadecane-15,16,17,18-tetrol |
|---|---|
| PubChem CID | 20871358 |
| Molecular Formula | C16H28O9 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 5-(hydroxymethyl)-14-methyl-2,4,11,13-tetraoxatricyclo[10.2.2.23,6]octadecane-15,16,17,18-tetrol |
| SMILES | CC1OC2OCCCCC3C(CO)OC(OC1C(O)C2O)C(O)C3O |
| InChI | InChI=1S/C16H28O9/c1-7-14-11(19)13(21)15(23-7)22-5-3-2-4-8-9(6-17)24-16(25-14)12(20)10(8)18/h7-21H,2-6H2,1H3 |
| InChIKey | WWAVULHTORUKKG-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |