C17H30O9 — CID 70861837
(3R,12S,15S,17R)-5-ethyl-14-(hydroxymethyl)-2,4,11,13-tetraoxatricyclo[10.2.2.23,6]octadecane-15,16,17,18-tetrol (PubChem CID 70861837) has the molecular formula C17H30O9 and a molecular weight of 378.42 g/mol. Its IUPAC name is (3R,12S,15S,17R)-5-ethyl-14-(hydroxymethyl)-2,4,11,13-tetraoxatricyclo[10.2.2.23,6]octadecane-15,16,17,18-tetrol.
| Compound Name | (3R,12S,15S,17R)-5-ethyl-14-(hydroxymethyl)-2,4,11,13-tetraoxatricyclo[10.2.2.23,6]octadecane-15,16,17,18-tetrol |
|---|---|
| PubChem CID | 70861837 |
| Molecular Formula | C17H30O9 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (3R,12S,15S,17R)-5-ethyl-14-(hydroxymethyl)-2,4,11,13-tetraoxatricyclo[10.2.2.23,6]octadecane-15,16,17,18-tetrol |
| SMILES | CCC1O[C@@H]2OC3C(CO)O[C@H](OCCCCC1[C@@H](O)C2O)C(O)[C@@H]3O |
| InChI | InChI=1S/C17H30O9/c1-2-9-8-5-3-4-6-23-16-14(22)12(20)15(10(7-18)25-16)26-17(24-9)13(21)11(8)19/h8-22H,2-7H2,1H3/t8?,9?,10?,11-,12+,13?,14?,15?,16+,17-/m1/s1 |
| InChIKey | CHNAVASHRGHDGP-FGADWEHLSA-N |
| XLogP | -1.52 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |