C22H39NO9S2 — CID 89127859
N-methyl-4-[[(3R,13S,16S,17S,18R,19S)-16,17,18,19-tetrahydroxy-5-(hydroxymethyl)-2,4,12,14-tetraoxatricyclo[11.2.2.23,6]nonadecan-15-yl]methylsulfanyl]butanethioamide (PubChem CID 89127859) has the molecular formula C22H39NO9S2 and a molecular weight of 525.69 g/mol. Its IUPAC name is N-methyl-4-[[(3R,13S,16S,17S,18R,19S)-16,17,18,19-tetrahydroxy-5-(hydroxymethyl)-2,4,12,14-tetraoxatricyclo[11.2.2.23,6]nonadecan-15-yl]methylsulfanyl]butanethioamide.
| Compound Name | N-methyl-4-[[(3R,13S,16S,17S,18R,19S)-16,17,18,19-tetrahydroxy-5-(hydroxymethyl)-2,4,12,14-tetraoxatricyclo[11.2.2.23,6]nonadecan-15-yl]methylsulfanyl]butanethioamide |
|---|---|
| PubChem CID | 89127859 |
| Molecular Formula | C22H39NO9S2 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | N-methyl-4-[[(3R,13S,16S,17S,18R,19S)-16,17,18,19-tetrahydroxy-5-(hydroxymethyl)-2,4,12,14-tetraoxatricyclo[11.2.2.23,6]nonadecan-15-yl]methylsulfanyl]butanethioamide |
| SMILES | CNC(=S)CCCSCC1O[C@@H]2OCCCCCC3C(CO)O[C@H](OC1[C@@H](O)[C@@H]2O)[C@@H](O)[C@@H]3O |
| InChI | InChI=1S/C22H39NO9S2/c1-23-15(33)7-5-9-34-11-14-20-17(26)19(28)21(31-14)29-8-4-2-3-6-12-13(10-24)30-22(32-20)18(27)16(12)25/h12-14,16-22,24-28H,2-11H2,1H3,(H,23,33)/t12?,13?,14?,16-,17+,18+,19+,20?,21+,22-/m1/s1 |
| InChIKey | IDNLLVLYALWSFF-YBTRWRCZSA-N |
| XLogP | -0.48 |
| TPSA | 150.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|