C13H26ClNO5S — CID 123638814
9-(4-aminobutylsulfanylmethyl)-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride (PubChem CID 123638814) has the molecular formula C13H26ClNO5S and a molecular weight of 343.87 g/mol. Its IUPAC name is 9-(4-aminobutylsulfanylmethyl)-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride.
| Compound Name | 9-(4-aminobutylsulfanylmethyl)-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride |
|---|---|
| PubChem CID | 123638814 |
| Molecular Formula | C13H26ClNO5S |
| Molecular Weight | 343.87 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 9-(4-aminobutylsulfanylmethyl)-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride |
| SMILES | Cl.NCCCCSCC1OC2OCCCOC1C(O)C2O |
| InChI | InChI=1S/C13H25NO5S.ClH/c14-4-1-2-7-20-8-9-12-10(15)11(16)13(19-9)18-6-3-5-17-12;/h9-13,15-16H,1-8,14H2;1H |
| InChIKey | OBQOCIGGNLTADL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.87 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|