C13H27N3O5S — CID 160771980
2-[2-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methylsulfanyl]ethyl]guanidine;methane (PubChem CID 160771980) has the molecular formula C13H27N3O5S and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-[2-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methylsulfanyl]ethyl]guanidine;methane.
| Compound Name | 2-[2-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methylsulfanyl]ethyl]guanidine;methane |
|---|---|
| PubChem CID | 160771980 |
| Molecular Formula | C13H27N3O5S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[2-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methylsulfanyl]ethyl]guanidine;methane |
| SMILES | C.NC(N)=NCCSCC1OC2OCCCOC1C(O)C2O |
| InChI | InChI=1S/C12H23N3O5S.CH4/c13-12(14)15-2-5-21-6-7-10-8(16)9(17)11(20-7)19-4-1-3-18-10;/h7-11,16-17H,1-6H2,(H4,13,14,15);1H4 |
| InChIKey | RZLADRWPVYFVLI-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|