C15H21NO6 — CID 59343176
9-[(4-hydroxyanilino)methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol (PubChem CID 59343176) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is 9-[(4-hydroxyanilino)methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol.
| Compound Name | 9-[(4-hydroxyanilino)methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol |
|---|---|
| PubChem CID | 59343176 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 9-[(4-hydroxyanilino)methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol |
| SMILES | Oc1ccc(NCC2OC3OCCCOC2C(O)C3O)cc1 |
| InChI | InChI=1S/C15H21NO6/c17-10-4-2-9(3-5-10)16-8-11-14-12(18)13(19)15(22-11)21-7-1-6-20-14/h2-5,11-19H,1,6-8H2 |
| InChIKey | ONXDHHQZEFLSCX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|