C18H23N3O5 — CID 59343187
9-[(4-benzyltriazol-1-yl)methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol (PubChem CID 59343187) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is 9-[(4-benzyltriazol-1-yl)methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol.
| Compound Name | 9-[(4-benzyltriazol-1-yl)methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol |
|---|---|
| PubChem CID | 59343187 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 9-[(4-benzyltriazol-1-yl)methyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol |
| SMILES | OC1C2OCCCOC(C(Cn3cc(Cc4ccccc4)nn3)O2)C1O |
| InChI | InChI=1S/C18H23N3O5/c22-15-16(23)18-25-8-4-7-24-17(15)14(26-18)11-21-10-13(19-20-21)9-12-5-2-1-3-6-12/h1-3,5-6,10,14-18,22-23H,4,7-9,11H2 |
| InChIKey | IQWKUFCTKDUXQA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |