C18H23N3O4 — CID 24879356
1-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-4-benzyltriazole (PubChem CID 24879356) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-4-benzyltriazole.
| Compound Name | 1-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-4-benzyltriazole |
|---|---|
| PubChem CID | 24879356 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-4-benzyltriazole |
| SMILES | CO[C@@H]1O[C@H](Cn2cc(Cc3ccccc3)nn2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H23N3O4/c1-18(2)24-15-14(23-17(22-3)16(15)25-18)11-21-10-13(19-20-21)9-12-7-5-4-6-8-12/h4-8,10,14-17H,9,11H2,1-3H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | XZFXTEWNRWKWNP-QBPKDAKJSA-N |
| XLogP | 1.76 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |