C16H20N2O4 — CID 101070321
1-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]benzimidazole (PubChem CID 101070321) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]benzimidazole.
| Compound Name | 1-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]benzimidazole |
|---|---|
| PubChem CID | 101070321 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]benzimidazole |
| SMILES | CO[C@@H]1O[C@H](Cn2cnc3ccccc32)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H20N2O4/c1-16(2)21-13-12(20-15(19-3)14(13)22-16)8-18-9-17-10-6-4-5-7-11(10)18/h4-7,9,12-15H,8H2,1-3H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | IRSPRVAPKMOMSY-KBUPBQIOSA-N |
| XLogP | 1.93 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |