C23H26N4O7 — CID 139050538
1-[[1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indole-2,3-dione (PubChem CID 139050538) has the molecular formula C23H26N4O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is 1-[[1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indole-2,3-dione.
| Compound Name | 1-[[1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 139050538 |
| Molecular Formula | C23H26N4O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 1-[[1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indole-2,3-dione |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](Cn1cc(CN3C(=O)C(=O)c4ccccc43)nn1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C23H26N4O7/c1-22(2)31-17-15(30-21-19(18(17)32-22)33-23(3,4)34-21)11-26-9-12(24-25-26)10-27-14-8-6-5-7-13(14)16(28)20(27)29/h5-9,15,17-19,21H,10-11H2,1-4H3/t15-,17+,18+,19-,21-/m1/s1 |
| InChIKey | QMGXJBBQUCZMNT-YXRUOGEQSA-N |
| XLogP | 1.40 |
| TPSA | 114.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|