C19H25N5O7 — CID 122205302
1-[[1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]pyrimidine-2,4-dione (PubChem CID 122205302) has the molecular formula C19H25N5O7 and a molecular weight of 435.44 g/mol. Its IUPAC name is 1-[[1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[[1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 122205302 |
| Molecular Formula | C19H25N5O7 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-[[1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]pyrimidine-2,4-dione |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](Cn1cc(Cn3ccc(=O)[nH]c3=O)nn1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C19H25N5O7/c1-18(2)28-13-11(27-16-15(14(13)29-18)30-19(3,4)31-16)9-24-8-10(21-22-24)7-23-6-5-12(25)20-17(23)26/h5-6,8,11,13-16H,7,9H2,1-4H3,(H,20,25,26)/t11-,13+,14+,15-,16-/m1/s1 |
| InChIKey | PCZSLPARSSCODR-DZQJYWQESA-N |
| XLogP | -0.43 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |