C19H28N8O9 — CID 46871742
2-[[1-[[(2R,3S,4R,5R)-5-[[(2R,3S,4S,5S)-5-[(2,4-dioxopyrimidin-1-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methoxy]-3,4-dihydroxyoxolan-2-yl]methyl]triazol-4-yl]methyl]guanidine (PubChem CID 46871742) has the molecular formula C19H28N8O9 and a molecular weight of 512.48 g/mol. Its IUPAC name is 2-[[1-[[(2R,3S,4R,5R)-5-[[(2R,3S,4S,5S)-5-[(2,4-dioxopyrimidin-1-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methoxy]-3,4-dihydroxyoxolan-2-yl]methyl]triazol-4-yl]methyl]guanidine.
| Compound Name | 2-[[1-[[(2R,3S,4R,5R)-5-[[(2R,3S,4S,5S)-5-[(2,4-dioxopyrimidin-1-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methoxy]-3,4-dihydroxyoxolan-2-yl]methyl]triazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 46871742 |
| Molecular Formula | C19H28N8O9 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 2-[[1-[[(2R,3S,4R,5R)-5-[[(2R,3S,4S,5S)-5-[(2,4-dioxopyrimidin-1-yl)methyl]-3,4-dihydroxyoxolan-2-yl]methoxy]-3,4-dihydroxyoxolan-2-yl]methyl]triazol-4-yl]methyl]guanidine |
| SMILES | NC(N)=NCc1cn(C[C@H]2O[C@@H](OC[C@H]3O[C@@H](Cn4ccc(=O)[nH]c4=O)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H]2O)nn1 |
| InChI | InChI=1S/C19H28N8O9/c20-18(21)22-3-8-4-27(25-24-8)6-10-14(30)16(32)17(36-10)34-7-11-15(31)13(29)9(35-11)5-26-2-1-12(28)23-19(26)33/h1-2,4,9-11,13-17,29-32H,3,5-7H2,(H4,20,21,22)(H,23,28,33)/t9-,10+,11+,13+,14+,15+,16+,17+/m0/s1 |
| InChIKey | YZPRHDXZPATVTF-CFGOVTMJSA-N |
| XLogP | -5.45 |
| TPSA | 258.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | -5.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|