C25H33N5O8 — CID 166441638
5-amino-3,3-dimethoxy-1-[[1-[[(1R,2S,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indol-2-one (PubChem CID 166441638) has the molecular formula C25H33N5O8 and a molecular weight of 531.57 g/mol. Its IUPAC name is 5-amino-3,3-dimethoxy-1-[[1-[[(1R,2S,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indol-2-one.
| Compound Name | 5-amino-3,3-dimethoxy-1-[[1-[[(1R,2S,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indol-2-one |
|---|---|
| PubChem CID | 166441638 |
| Molecular Formula | C25H33N5O8 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 5-amino-3,3-dimethoxy-1-[[1-[[(1R,2S,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indol-2-one |
| SMILES | COC1(OC)C(=O)N(Cc2cn(C[C@H]3O[C@H]4OC(C)(C)O[C@H]4[C@@H]4OC(C)(C)O[C@@H]43)nn2)c2ccc(N)cc21 |
| InChI | InChI=1S/C25H33N5O8/c1-23(2)35-18-17(34-21-20(19(18)36-23)37-24(3,4)38-21)12-29-10-14(27-28-29)11-30-16-8-7-13(26)9-15(16)25(32-5,33-6)22(30)31/h7-10,17-21H,11-12,26H2,1-6H3/t17-,18-,19-,20+,21+/m1/s1 |
| InChIKey | RKOUJSKXJOFSCM-XKRYSZRTSA-N |
| XLogP | 1.25 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|