C30H30N6O4 — CID 122380960
1-[[1-[[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]triazol-4-yl]methyl]-2-pyridin-2-ylbenzimidazole (PubChem CID 122380960) has the molecular formula C30H30N6O4 and a molecular weight of 538.61 g/mol. Its IUPAC name is 1-[[1-[[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]triazol-4-yl]methyl]-2-pyridin-2-ylbenzimidazole.
| Compound Name | 1-[[1-[[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]triazol-4-yl]methyl]-2-pyridin-2-ylbenzimidazole |
|---|---|
| PubChem CID | 122380960 |
| Molecular Formula | C30H30N6O4 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 1-[[1-[[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]triazol-4-yl]methyl]-2-pyridin-2-ylbenzimidazole |
| SMILES | CC1(C)O[C@H]2O[C@H](Cn3cc(Cn4c(-c5ccccn5)nc5ccccc54)nn3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C30H30N6O4/c1-30(2)39-27-26(37-19-20-10-4-3-5-11-20)25(38-29(27)40-30)18-35-16-21(33-34-35)17-36-24-14-7-6-12-22(24)32-28(36)23-13-8-9-15-31-23/h3-16,25-27,29H,17-19H2,1-2H3/t25-,26+,27-,29-/m1/s1 |
| InChIKey | OAUDVRHHAPLIGB-LLNGEMMXSA-N |
| XLogP | 4.20 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |