C14H26N2O6 — CID 59343141
5-amino-N-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]pentanamide (PubChem CID 59343141) has the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. Its IUPAC name is 5-amino-N-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]pentanamide.
| Compound Name | 5-amino-N-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 59343141 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 5-amino-N-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]pentanamide |
| SMILES | NCCCCC(=O)NCC1OC2OCCCOC1C(O)C2O |
| InChI | InChI=1S/C14H26N2O6/c15-5-2-1-4-10(17)16-8-9-13-11(18)12(19)14(22-9)21-7-3-6-20-13/h9,11-14,18-19H,1-8,15H2,(H,16,17) |
| InChIKey | ZPIWWBSMZLRLBN-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|