C11H22ClNO5S — CID 123773148
9-(2-aminoethylsulfanylmethyl)-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride (PubChem CID 123773148) has the molecular formula C11H22ClNO5S and a molecular weight of 315.82 g/mol. Its IUPAC name is 9-(2-aminoethylsulfanylmethyl)-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride.
| Compound Name | 9-(2-aminoethylsulfanylmethyl)-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride |
|---|---|
| PubChem CID | 123773148 |
| Molecular Formula | C11H22ClNO5S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 9-(2-aminoethylsulfanylmethyl)-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride |
| SMILES | Cl.NCCSCC1OC2OCCCOC1C(O)C2O |
| InChI | InChI=1S/C11H21NO5S.ClH/c12-2-5-18-6-7-10-8(13)9(14)11(17-7)16-4-1-3-15-10;/h7-11,13-14H,1-6,12H2;1H |
| InChIKey | ZQCVUILKBJXRFP-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|