C20H23F2NO3 — CID 20872683
(2,4-difluorophenyl) N-[1-(4-butoxyphenyl)propyl]carbamate (PubChem CID 20872683) has the molecular formula C20H23F2NO3 and a molecular weight of 363.40 g/mol. Its IUPAC name is (2,4-difluorophenyl) N-[1-(4-butoxyphenyl)propyl]carbamate.
| Compound Name | (2,4-difluorophenyl) N-[1-(4-butoxyphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 20872683 |
| Molecular Formula | C20H23F2NO3 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (2,4-difluorophenyl) N-[1-(4-butoxyphenyl)propyl]carbamate |
| SMILES | CCCCOc1ccc(C(CC)NC(=O)Oc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H23F2NO3/c1-3-5-12-25-16-9-6-14(7-10-16)18(4-2)23-20(24)26-19-11-8-15(21)13-17(19)22/h6-11,13,18H,3-5,12H2,1-2H3,(H,23,24) |
| InChIKey | OUGGRSQJZDSDPU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|