C11H9BrN4O3 — CID 20877004
1-(3-bromophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea (PubChem CID 20877004) has the molecular formula C11H9BrN4O3 and a molecular weight of 325.12 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea.
| Compound Name | 1-(3-bromophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 20877004 |
| Molecular Formula | C11H9BrN4O3 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea |
| SMILES | O=C(Nc1cccc(Br)c1)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H9BrN4O3/c12-6-2-1-3-7(4-6)14-11(19)15-8-5-13-10(18)16-9(8)17/h1-5H,(H2,14,15,19)(H2,13,16,17,18) |
| InChIKey | YNXVOXGYVLWIKI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |